C14H25N7O6S3 — CID 163360409
methyl N-[[[[2-(dimethylamino)-1-methylsulfanyl-2-oxoethylidene]amino]oxycarbonyl-methylamino]sulfanyl-methylcarbamoyl]oxy-2-(2,2-dimethylhydrazinyl)-2-oxoethanimidothioate (PubChem CID 163360409) has the molecular formula C14H25N7O6S3 and a molecular weight of 483.60 g/mol. Its IUPAC name is methyl N-[[[[2-(dimethylamino)-1-methylsulfanyl-2-oxoethylidene]amino]oxycarbonyl-methylamino]sulfanyl-methylcarbamoyl]oxy-2-(2,2-dimethylhydrazinyl)-2-oxoethanimidothioate.
| Compound Name | methyl N-[[[[2-(dimethylamino)-1-methylsulfanyl-2-oxoethylidene]amino]oxycarbonyl-methylamino]sulfanyl-methylcarbamoyl]oxy-2-(2,2-dimethylhydrazinyl)-2-oxoethanimidothioate |
|---|---|
| PubChem CID | 163360409 |
| Molecular Formula | C14H25N7O6S3 |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | methyl N-[[[[2-(dimethylamino)-1-methylsulfanyl-2-oxoethylidene]amino]oxycarbonyl-methylamino]sulfanyl-methylcarbamoyl]oxy-2-(2,2-dimethylhydrazinyl)-2-oxoethanimidothioate |
| SMILES | CSC(=NOC(=O)N(C)SN(C)C(=O)ON=C(SC)C(=O)N(C)C)C(=O)NN(C)C |
| InChI | InChI=1S/C14H25N7O6S3/c1-18(2)12(23)11(29-8)17-27-14(25)21(6)30-20(5)13(24)26-16-10(28-7)9(22)15-19(3)4/h1-8H3,(H,15,22) |
| InChIKey | CJOIKZGVXCMKTQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|