C9H19N3O2S2 — CID 54003718
[(2-methyl-2-methylsulfanylpropylidene)amino] N-(dimethylaminosulfanyl)-N-methylcarbamate (PubChem CID 54003718) has the molecular formula C9H19N3O2S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is [(2-methyl-2-methylsulfanylpropylidene)amino] N-(dimethylaminosulfanyl)-N-methylcarbamate.
| Compound Name | [(2-methyl-2-methylsulfanylpropylidene)amino] N-(dimethylaminosulfanyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 54003718 |
| Molecular Formula | C9H19N3O2S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [(2-methyl-2-methylsulfanylpropylidene)amino] N-(dimethylaminosulfanyl)-N-methylcarbamate |
| SMILES | CSC(C)(C)C=NOC(=O)N(C)SN(C)C |
| InChI | InChI=1S/C9H19N3O2S2/c1-9(2,15-6)7-10-14-8(13)12(5)16-11(3)4/h7H,1-6H3 |
| InChIKey | KNJSMQFEIKXSFD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|