C19H25N3O4S — CID 87504977
[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;naphthalen-1-yl N-methylcarbamate (PubChem CID 87504977) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;naphthalen-1-yl N-methylcarbamate.
| Compound Name | [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;naphthalen-1-yl N-methylcarbamate |
|---|---|
| PubChem CID | 87504977 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;naphthalen-1-yl N-methylcarbamate |
| SMILES | CNC(=O)O/N=C/C(C)(C)SC.CNC(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C12H11NO2.C7H14N2O2S/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11;1-7(2,12-4)5-9-11-6(10)8-3/h2-8H,1H3,(H,13,14);5H,1-4H3,(H,8,10)/b;9-5+ |
| InChIKey | WWQOEFQUXCKVCV-DTDKZNDQSA-N |
| XLogP | 4.03 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|