C11H18N4O4S3 — CID 143167326
methyl (1E)-N-[[[(E)-1-ethenylsulfanylethylideneamino]oxycarbonyl-methylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate (PubChem CID 143167326) has the molecular formula C11H18N4O4S3 and a molecular weight of 366.49 g/mol. Its IUPAC name is methyl (1E)-N-[[[(E)-1-ethenylsulfanylethylideneamino]oxycarbonyl-methylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate.
| Compound Name | methyl (1E)-N-[[[(E)-1-ethenylsulfanylethylideneamino]oxycarbonyl-methylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 143167326 |
| Molecular Formula | C11H18N4O4S3 |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | methyl (1E)-N-[[[(E)-1-ethenylsulfanylethylideneamino]oxycarbonyl-methylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
| SMILES | C=CS/C(C)=N/OC(=O)N(C)SN(C)C(=O)O/N=C(\C)SC |
| InChI | InChI=1S/C11H18N4O4S3/c1-7-21-9(3)13-19-11(17)15(5)22-14(4)10(16)18-12-8(2)20-6/h7H,1H2,2-6H3/b12-8+,13-9+ |
| InChIKey | HHUACYHTHCETLN-QHKWOANTSA-N |
| XLogP | 3.59 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|