C13H25N3O5S2 — CID 54263353
ethyl 3-[2-methoxyethyl-[methyl-(1-methylsulfanylethylideneamino)oxycarbonylamino]sulfanylamino]propanoate (PubChem CID 54263353) has the molecular formula C13H25N3O5S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl 3-[2-methoxyethyl-[methyl-(1-methylsulfanylethylideneamino)oxycarbonylamino]sulfanylamino]propanoate.
| Compound Name | ethyl 3-[2-methoxyethyl-[methyl-(1-methylsulfanylethylideneamino)oxycarbonylamino]sulfanylamino]propanoate |
|---|---|
| PubChem CID | 54263353 |
| Molecular Formula | C13H25N3O5S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl 3-[2-methoxyethyl-[methyl-(1-methylsulfanylethylideneamino)oxycarbonylamino]sulfanylamino]propanoate |
| SMILES | CCOC(=O)CCN(CCOC)SN(C)C(=O)ON=C(C)SC |
| InChI | InChI=1S/C13H25N3O5S2/c1-6-20-12(17)7-8-16(9-10-19-4)23-15(3)13(18)21-14-11(2)22-5/h6-10H2,1-5H3 |
| InChIKey | RFAWHFGYPLDDSP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|