C11H21N3O5S2 — CID 88701955
methyl 3-[[(ethanethioylamino)oxycarbonyl-methylamino]sulfanyl-(2-methoxyethyl)amino]propanoate (PubChem CID 88701955) has the molecular formula C11H21N3O5S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is methyl 3-[[(ethanethioylamino)oxycarbonyl-methylamino]sulfanyl-(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[[(ethanethioylamino)oxycarbonyl-methylamino]sulfanyl-(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 88701955 |
| Molecular Formula | C11H21N3O5S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | methyl 3-[[(ethanethioylamino)oxycarbonyl-methylamino]sulfanyl-(2-methoxyethyl)amino]propanoate |
| SMILES | COCCN(CCC(=O)OC)SN(C)C(=O)ONC(C)=S |
| InChI | InChI=1S/C11H21N3O5S2/c1-9(20)12-19-11(16)13(2)21-14(7-8-17-3)6-5-10(15)18-4/h5-8H2,1-4H3,(H,12,20) |
| InChIKey | LKHYKDNYXLSJEG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|