C12H26N3O5PS2 — CID 6510020
methyl (1Z)-N-[[diethoxyphosphoryl(propan-2-yl)amino]sulfanyl-methylcarbamoyl]oxyethanimidothioate (PubChem CID 6510020) has the molecular formula C12H26N3O5PS2 and a molecular weight of 387.46 g/mol. Its IUPAC name is methyl (1Z)-N-[[diethoxyphosphoryl(propan-2-yl)amino]sulfanyl-methylcarbamoyl]oxyethanimidothioate.
| Compound Name | methyl (1Z)-N-[[diethoxyphosphoryl(propan-2-yl)amino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 6510020 |
| Molecular Formula | C12H26N3O5PS2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | methyl (1Z)-N-[[diethoxyphosphoryl(propan-2-yl)amino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
| SMILES | CCOP(=O)(OCC)N(SN(C)C(=O)O/N=C(/C)SC)C(C)C |
| InChI | InChI=1S/C12H26N3O5PS2/c1-8-18-21(17,19-9-2)15(10(3)4)23-14(6)12(16)20-13-11(5)22-7/h10H,8-9H2,1-7H3/b13-11- |
| InChIKey | KRZWARAFKHUJIY-QBFSEMIESA-N |
| XLogP | 4.21 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|