C14H26N4O4S4 — CID 57076311
propan-2-yl N-[methyl-[[methyl-(1-propan-2-ylsulfanylethylideneamino)oxycarbonylamino]disulfanyl]carbamoyl]oxyethanimidothioate (PubChem CID 57076311) has the molecular formula C14H26N4O4S4 and a molecular weight of 442.65 g/mol. Its IUPAC name is propan-2-yl N-[methyl-[[methyl-(1-propan-2-ylsulfanylethylideneamino)oxycarbonylamino]disulfanyl]carbamoyl]oxyethanimidothioate.
| Compound Name | propan-2-yl N-[methyl-[[methyl-(1-propan-2-ylsulfanylethylideneamino)oxycarbonylamino]disulfanyl]carbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 57076311 |
| Molecular Formula | C14H26N4O4S4 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | propan-2-yl N-[methyl-[[methyl-(1-propan-2-ylsulfanylethylideneamino)oxycarbonylamino]disulfanyl]carbamoyl]oxyethanimidothioate |
| SMILES | CC(=NOC(=O)N(C)SSN(C)C(=O)ON=C(C)SC(C)C)SC(C)C |
| InChI | InChI=1S/C14H26N4O4S4/c1-9(2)23-11(5)15-21-13(19)17(7)25-26-18(8)14(20)22-16-12(6)24-10(3)4/h9-10H,1-8H3 |
| InChIKey | ISWHVEYNBNGDTA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|