C9H15Cl3N2O3S — CID 88799958
[(E)-(3-methoxy-3-methylbutan-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate (PubChem CID 88799958) has the molecular formula C9H15Cl3N2O3S and a molecular weight of 337.66 g/mol. Its IUPAC name is [(E)-(3-methoxy-3-methylbutan-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate.
| Compound Name | [(E)-(3-methoxy-3-methylbutan-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate |
|---|---|
| PubChem CID | 88799958 |
| Molecular Formula | C9H15Cl3N2O3S |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | [(E)-(3-methoxy-3-methylbutan-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate |
| SMILES | COC(C)(C)/C(C)=N/OC(=O)N(C)SC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H15Cl3N2O3S/c1-6(8(2,3)16-5)13-17-7(15)14(4)18-9(10,11)12/h1-5H3/b13-6+ |
| InChIKey | QLMDGGXESWERER-AWNIVKPZSA-N |
| XLogP | 3.83 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|