C7H12N2O3S — CID 5360870
methyl (1E)-N-[acetyl(methyl)carbamoyl]oxyethanimidothioate (PubChem CID 5360870) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is methyl (1E)-N-[acetyl(methyl)carbamoyl]oxyethanimidothioate.
| Compound Name | methyl (1E)-N-[acetyl(methyl)carbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 5360870 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | methyl (1E)-N-[acetyl(methyl)carbamoyl]oxyethanimidothioate |
| SMILES | CS/C(C)=N/OC(=O)N(C)C(C)=O |
| InChI | InChI=1S/C7H12N2O3S/c1-5(13-4)8-12-7(11)9(3)6(2)10/h1-4H3/b8-5+ |
| InChIKey | MZCCXHGXCPDCFF-VMPITWQZSA-N |
| XLogP | 1.30 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|