C14H27N3O4S2 — CID 54546689
ethyl 3-[[methyl-(1-methylsulfanylethylideneamino)oxycarbonylamino]sulfanyl-(2-methylpropyl)amino]propanoate (PubChem CID 54546689) has the molecular formula C14H27N3O4S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is ethyl 3-[[methyl-(1-methylsulfanylethylideneamino)oxycarbonylamino]sulfanyl-(2-methylpropyl)amino]propanoate.
| Compound Name | ethyl 3-[[methyl-(1-methylsulfanylethylideneamino)oxycarbonylamino]sulfanyl-(2-methylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 54546689 |
| Molecular Formula | C14H27N3O4S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | ethyl 3-[[methyl-(1-methylsulfanylethylideneamino)oxycarbonylamino]sulfanyl-(2-methylpropyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(CC(C)C)SN(C)C(=O)ON=C(C)SC |
| InChI | InChI=1S/C14H27N3O4S2/c1-7-20-13(18)8-9-17(10-11(2)3)23-16(5)14(19)21-15-12(4)22-6/h11H,7-10H2,1-6H3 |
| InChIKey | ZGZWVGDZNHSDAA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|