C15H22N3O4PS3 — CID 88733596
methyl (1E)-N-[methyl-[2-methylpropyl-(2-sulfanylidene-1,3,2λ5-benzodioxaphosphol-2-yl)amino]sulfanylcarbamoyl]oxyethanimidothioate (PubChem CID 88733596) has the molecular formula C15H22N3O4PS3 and a molecular weight of 435.53 g/mol. Its IUPAC name is methyl (1E)-N-[methyl-[2-methylpropyl-(2-sulfanylidene-1,3,2λ5-benzodioxaphosphol-2-yl)amino]sulfanylcarbamoyl]oxyethanimidothioate.
| Compound Name | methyl (1E)-N-[methyl-[2-methylpropyl-(2-sulfanylidene-1,3,2λ5-benzodioxaphosphol-2-yl)amino]sulfanylcarbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 88733596 |
| Molecular Formula | C15H22N3O4PS3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | methyl (1E)-N-[methyl-[2-methylpropyl-(2-sulfanylidene-1,3,2λ5-benzodioxaphosphol-2-yl)amino]sulfanylcarbamoyl]oxyethanimidothioate |
| SMILES | CS/C(C)=N/OC(=O)N(C)SN(CC(C)C)P1(=S)Oc2ccccc2O1 |
| InChI | InChI=1S/C15H22N3O4PS3/c1-11(2)10-18(26-17(4)15(19)20-16-12(3)25-5)23(24)21-13-8-6-7-9-14(13)22-23/h6-9,11H,10H2,1-5H3/b16-12+ |
| InChIKey | OXCAIMZPXVHWEX-FOWTUZBSSA-N |
| XLogP | 4.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|