C17H28N3O3PS3 — CID 88776813
methyl (1E)-N-[[[phenyl(propan-2-yloxy)phosphinothioyl]-propan-2-ylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate (PubChem CID 88776813) has the molecular formula C17H28N3O3PS3 and a molecular weight of 449.60 g/mol. Its IUPAC name is methyl (1E)-N-[[[phenyl(propan-2-yloxy)phosphinothioyl]-propan-2-ylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate.
| Compound Name | methyl (1E)-N-[[[phenyl(propan-2-yloxy)phosphinothioyl]-propan-2-ylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
|---|---|
| PubChem CID | 88776813 |
| Molecular Formula | C17H28N3O3PS3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | methyl (1E)-N-[[[phenyl(propan-2-yloxy)phosphinothioyl]-propan-2-ylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
| SMILES | CS/C(C)=N/OC(=O)NCSN(C(C)C)P(=S)(OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H28N3O3PS3/c1-13(2)20(27-12-18-17(21)22-19-15(5)26-6)24(25,23-14(3)4)16-10-8-7-9-11-16/h7-11,13-14H,12H2,1-6H3,(H,18,21)/b19-15+ |
| InChIKey | VFNPJFXFZSMORE-XDJHFCHBSA-N |
| XLogP | 4.79 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|