C19H23ClN3O3PS3 — CID 88814837
methyl N-[[N-chloro-2-[ethyl(phenoxy)phosphinothioyl]anilino]sulfanyl-methylcarbamoyl]oxyethanimidothioate (PubChem CID 88814837) has the molecular formula C19H23ClN3O3PS3 and a molecular weight of 504.04 g/mol. Its IUPAC name is methyl N-[[N-chloro-2-[ethyl(phenoxy)phosphinothioyl]anilino]sulfanyl-methylcarbamoyl]oxyethanimidothioate.
| Compound Name | methyl N-[[N-chloro-2-[ethyl(phenoxy)phosphinothioyl]anilino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 88814837 |
| Molecular Formula | C19H23ClN3O3PS3 |
| Molecular Weight | 504.04 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | methyl N-[[N-chloro-2-[ethyl(phenoxy)phosphinothioyl]anilino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
| SMILES | CCP(=S)(Oc1ccccc1)c1ccccc1N(Cl)SN(C)C(=O)ON=C(C)SC |
| InChI | InChI=1S/C19H23ClN3O3PS3/c1-5-27(28,26-16-11-7-6-8-12-16)18-14-10-9-13-17(18)23(20)30-22(3)19(24)25-21-15(2)29-4/h6-14H,5H2,1-4H3 |
| InChIKey | JUZKCBMONHJUPF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.04 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|