About methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate
methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate (PubChem CID 177462973) has the molecular formula C13H15Cl2N3O3S2
and a molecular weight of 396.32 g/mol. Its IUPAC name is methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate.
Molecular Properties
| Compound Name | methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
| PubChem CID | 177462973 |
| Molecular Formula | C13H15Cl2N3O3S2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
| SMILES | CS/C(C)=N/OC(=O)NCSN(C)C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H15Cl2N3O3S2/c1-8(22-3)17-21-13(20)16-7-23-18(2)12(19)11-9(14)5-4-6-10(11)15/h4-6H,7H2,1-3H3,(H,16,20)/b17-8+ |
| InChIKey | XJNHJLANPKOUAY-CAOOACKPSA-N |
| XLogP | 4.09 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate?
The IUPAC name of methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate (CID 177462973) is methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate.
What is the SMILES notation for methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate?
The canonical SMILES for methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate is CS/C(C)=N/OC(=O)NCSN(C)C(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate?
The InChIKey is XJNHJLANPKOUAY-CAOOACKPSA-N. The full InChI is InChI=1S/C13H15Cl2N3O3S2/c1-8(22-3)17-21-13(20)16-7-23-18(2)12(19)11-9(14)5-4-6-10(11)15/h4-6H,7H2,1-3H3,(H,16,20)/b17-8+.
What are the key properties of methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate?
methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate has a molecular weight of 396.32 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1E)-N-[[(2,6-dichlorobenzoyl)-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate is sourced from PubChem (CID 177462973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).