C12H18N3O3PS3 — CID 88811697
(ethanethioylamino) N-methyl-N-[[methyl(phenoxy)phosphinothioyl]methylamino]sulfanylcarbamate (PubChem CID 88811697) has the molecular formula C12H18N3O3PS3 and a molecular weight of 379.47 g/mol. Its IUPAC name is (ethanethioylamino) N-methyl-N-[[methyl(phenoxy)phosphinothioyl]methylamino]sulfanylcarbamate.
| Compound Name | (ethanethioylamino) N-methyl-N-[[methyl(phenoxy)phosphinothioyl]methylamino]sulfanylcarbamate |
|---|---|
| PubChem CID | 88811697 |
| Molecular Formula | C12H18N3O3PS3 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | (ethanethioylamino) N-methyl-N-[[methyl(phenoxy)phosphinothioyl]methylamino]sulfanylcarbamate |
| SMILES | CC(=S)NOC(=O)N(C)SNCP(C)(=S)Oc1ccccc1 |
| InChI | InChI=1S/C12H18N3O3PS3/c1-10(20)14-17-12(16)15(2)22-13-9-19(3,21)18-11-7-5-4-6-8-11/h4-8,13H,9H2,1-3H3,(H,14,20) |
| InChIKey | BTBLOGLGNQSGKX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|