C15H22N4O4S2 — CID 157154650
methyl N-methyl-N-(methylcarbamothioyl)carbamate;phenyl N-methyl-N-(methylcarbamothioyl)carbamate (PubChem CID 157154650) has the molecular formula C15H22N4O4S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is methyl N-methyl-N-(methylcarbamothioyl)carbamate;phenyl N-methyl-N-(methylcarbamothioyl)carbamate.
| Compound Name | methyl N-methyl-N-(methylcarbamothioyl)carbamate;phenyl N-methyl-N-(methylcarbamothioyl)carbamate |
|---|---|
| PubChem CID | 157154650 |
| Molecular Formula | C15H22N4O4S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | methyl N-methyl-N-(methylcarbamothioyl)carbamate;phenyl N-methyl-N-(methylcarbamothioyl)carbamate |
| SMILES | CNC(=S)N(C)C(=O)OC.CNC(=S)N(C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C10H12N2O2S.C5H10N2O2S/c1-11-9(15)12(2)10(13)14-8-6-4-3-5-7-8;1-6-4(10)7(2)5(8)9-3/h3-7H,1-2H3,(H,11,15);1-3H3,(H,6,10) |
| InChIKey | ALQYEDAUMDZVFG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|