C13H20N3O3PS3 — CID 148919711
methyl N-[[[methoxy(phenyl)phosphinothioyl]-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate (PubChem CID 148919711) has the molecular formula C13H20N3O3PS3 and a molecular weight of 393.50 g/mol. Its IUPAC name is methyl N-[[[methoxy(phenyl)phosphinothioyl]-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate.
| Compound Name | methyl N-[[[methoxy(phenyl)phosphinothioyl]-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
|---|---|
| PubChem CID | 148919711 |
| Molecular Formula | C13H20N3O3PS3 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | methyl N-[[[methoxy(phenyl)phosphinothioyl]-methylamino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
| SMILES | COP(=S)(c1ccccc1)N(C)SCNC(=O)ON=C(C)SC |
| InChI | InChI=1S/C13H20N3O3PS3/c1-11(22-4)15-19-13(17)14-10-23-16(2)20(21,18-3)12-8-6-5-7-9-12/h5-9H,10H2,1-4H3,(H,14,17) |
| InChIKey | OEQZAXQTJWLREY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|