C13H26N3O5PS3 — CID 173428184
[(1-dimethoxyphosphinothioylcyclohexyl)amino]-[[(1-methylsulfanylethylideneamino)oxycarbonylamino]methyl]-oxidosulfanium (PubChem CID 173428184) has the molecular formula C13H26N3O5PS3 and a molecular weight of 431.54 g/mol. Its IUPAC name is [(1-dimethoxyphosphinothioylcyclohexyl)amino]-[[(1-methylsulfanylethylideneamino)oxycarbonylamino]methyl]-oxidosulfanium.
| Compound Name | [(1-dimethoxyphosphinothioylcyclohexyl)amino]-[[(1-methylsulfanylethylideneamino)oxycarbonylamino]methyl]-oxidosulfanium |
|---|---|
| PubChem CID | 173428184 |
| Molecular Formula | C13H26N3O5PS3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [(1-dimethoxyphosphinothioylcyclohexyl)amino]-[[(1-methylsulfanylethylideneamino)oxycarbonylamino]methyl]-oxidosulfanium |
| SMILES | COP(=S)(OC)C1(N[S+]([O-])CNC(=O)ON=C(C)SC)CCCCC1 |
| InChI | InChI=1S/C13H26N3O5PS3/c1-11(24-4)15-21-12(17)14-10-25(18)16-13(8-6-5-7-9-13)22(23,19-2)20-3/h16H,5-10H2,1-4H3,(H,14,17) |
| InChIKey | QNXADYRJXARTGN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|