C20H26N3O3PS3 — CID 88776706
methyl (1E)-N-[[benzyl-[ethoxy(phenyl)phosphinothioyl]amino]sulfanylmethylcarbamoyloxy]ethanimidothioate (PubChem CID 88776706) has the molecular formula C20H26N3O3PS3 and a molecular weight of 483.62 g/mol. Its IUPAC name is methyl (1E)-N-[[benzyl-[ethoxy(phenyl)phosphinothioyl]amino]sulfanylmethylcarbamoyloxy]ethanimidothioate.
| Compound Name | methyl (1E)-N-[[benzyl-[ethoxy(phenyl)phosphinothioyl]amino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
|---|---|
| PubChem CID | 88776706 |
| Molecular Formula | C20H26N3O3PS3 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | methyl (1E)-N-[[benzyl-[ethoxy(phenyl)phosphinothioyl]amino]sulfanylmethylcarbamoyloxy]ethanimidothioate |
| SMILES | CCOP(=S)(c1ccccc1)N(Cc1ccccc1)SCNC(=O)O/N=C(\C)SC |
| InChI | InChI=1S/C20H26N3O3PS3/c1-4-25-27(28,19-13-9-6-10-14-19)23(15-18-11-7-5-8-12-18)30-16-21-20(24)26-22-17(2)29-3/h5-14H,4,15-16H2,1-3H3,(H,21,24)/b22-17+ |
| InChIKey | PJODGVOOACOJFD-OQKWZONESA-N |
| XLogP | 5.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|