C18H26N3O4PS — CID 141174127
(E)-3-[benzyl-di(propan-2-yloxy)phosphorylamino]-2-cyano-4-sulfanylbut-2-enamide (PubChem CID 141174127) has the molecular formula C18H26N3O4PS and a molecular weight of 411.46 g/mol. Its IUPAC name is (E)-3-[benzyl-di(propan-2-yloxy)phosphorylamino]-2-cyano-4-sulfanylbut-2-enamide.
| Compound Name | (E)-3-[benzyl-di(propan-2-yloxy)phosphorylamino]-2-cyano-4-sulfanylbut-2-enamide |
|---|---|
| PubChem CID | 141174127 |
| Molecular Formula | C18H26N3O4PS |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (E)-3-[benzyl-di(propan-2-yloxy)phosphorylamino]-2-cyano-4-sulfanylbut-2-enamide |
| SMILES | CC(C)OP(=O)(OC(C)C)N(Cc1ccccc1)/C(CS)=C(\C#N)C(N)=O |
| InChI | InChI=1S/C18H26N3O4PS/c1-13(2)24-26(23,25-14(3)4)21(11-15-8-6-5-7-9-15)17(12-27)16(10-19)18(20)22/h5-9,13-14,27H,11-12H2,1-4H3,(H2,20,22)/b17-16+ |
| InChIKey | IYGLYHDWMVYTDZ-WUKNDPDISA-N |
| XLogP | 3.64 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|