C19H24N2O3 — CID 102205788
prop-2-enyl N-benzyl-N-[(3S)-1-cyano-5-methyl-2-oxohexan-3-yl]carbamate (PubChem CID 102205788) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is prop-2-enyl N-benzyl-N-[(3S)-1-cyano-5-methyl-2-oxohexan-3-yl]carbamate.
| Compound Name | prop-2-enyl N-benzyl-N-[(3S)-1-cyano-5-methyl-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 102205788 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | prop-2-enyl N-benzyl-N-[(3S)-1-cyano-5-methyl-2-oxohexan-3-yl]carbamate |
| SMILES | C=CCOC(=O)N(Cc1ccccc1)[C@@H](CC(C)C)C(=O)CC#N |
| InChI | InChI=1S/C19H24N2O3/c1-4-12-24-19(23)21(14-16-8-6-5-7-9-16)17(13-15(2)3)18(22)10-11-20/h4-9,15,17H,1,10,12-14H2,2-3H3/t17-/m0/s1 |
| InChIKey | SRWFZKSJDDVQDF-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|