C17H21FN2O3 — CID 24807470
methyl (2R)-2-[(2-cyanoacetyl)-[(4-fluorophenyl)methyl]amino]-4-methylpentanoate (PubChem CID 24807470) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is methyl (2R)-2-[(2-cyanoacetyl)-[(4-fluorophenyl)methyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[(2-cyanoacetyl)-[(4-fluorophenyl)methyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 24807470 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | methyl (2R)-2-[(2-cyanoacetyl)-[(4-fluorophenyl)methyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)N(Cc1ccc(F)cc1)C(=O)CC#N |
| InChI | InChI=1S/C17H21FN2O3/c1-12(2)10-15(17(22)23-3)20(16(21)8-9-19)11-13-4-6-14(18)7-5-13/h4-7,12,15H,8,10-11H2,1-3H3/t15-/m1/s1 |
| InChIKey | SJJJIVCCLPSXTI-OAHLLOKOSA-N |
| XLogP | 2.66 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |