C13H18N3O4PS3 — CID 88715916
[2-methylpropyl-(2-sulfanylidene-1,3,2λ5-benzodioxaphosphol-2-yl)amino]sulfanyl 2-carbamoyloxyethanimidothioate (PubChem CID 88715916) has the molecular formula C13H18N3O4PS3 and a molecular weight of 407.48 g/mol. Its IUPAC name is [2-methylpropyl-(2-sulfanylidene-1,3,2λ5-benzodioxaphosphol-2-yl)amino]sulfanyl 2-carbamoyloxyethanimidothioate.
| Compound Name | [2-methylpropyl-(2-sulfanylidene-1,3,2λ5-benzodioxaphosphol-2-yl)amino]sulfanyl 2-carbamoyloxyethanimidothioate |
|---|---|
| PubChem CID | 88715916 |
| Molecular Formula | C13H18N3O4PS3 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | [2-methylpropyl-(2-sulfanylidene-1,3,2λ5-benzodioxaphosphol-2-yl)amino]sulfanyl 2-carbamoyloxyethanimidothioate |
| SMILES | [H]/N=C(\COC(N)=O)SSN(CC(C)C)P1(=S)Oc2ccccc2O1 |
| InChI | InChI=1S/C13H18N3O4PS3/c1-9(2)7-16(24-23-12(14)8-18-13(15)17)21(22)19-10-5-3-4-6-11(10)20-21/h3-6,9,14H,7-8H2,1-2H3,(H2,15,17)/b14-12+ |
| InChIKey | ANEHVNYVBRQPRU-WYMLVPIESA-N |
| XLogP | 4.01 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|