C20H25N5O7S — CID 54502991
(2-prop-2-ynoxyphenyl) N-[[[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino]oxycarbonyl-methylamino]sulfanyl-N-methylcarbamate (PubChem CID 54502991) has the molecular formula C20H25N5O7S and a molecular weight of 479.52 g/mol. Its IUPAC name is (2-prop-2-ynoxyphenyl) N-[[[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino]oxycarbonyl-methylamino]sulfanyl-N-methylcarbamate.
| Compound Name | (2-prop-2-ynoxyphenyl) N-[[[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino]oxycarbonyl-methylamino]sulfanyl-N-methylcarbamate |
|---|---|
| PubChem CID | 54502991 |
| Molecular Formula | C20H25N5O7S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (2-prop-2-ynoxyphenyl) N-[[[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino]oxycarbonyl-methylamino]sulfanyl-N-methylcarbamate |
| SMILES | C#CCOc1ccccc1OC(=O)N(C)SN(C)C(=O)ON=C(C(=O)N(C)C)C(C)=NOC |
| InChI | InChI=1S/C20H25N5O7S/c1-8-13-30-15-11-9-10-12-16(15)31-19(27)24(5)33-25(6)20(28)32-22-17(14(2)21-29-7)18(26)23(3)4/h1,9-12H,13H2,2-7H3 |
| InChIKey | YDTCQOWKYGJRND-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 122.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|