C21H18F2O4 — CID 75304278
2-[2,2-difluoro-4-(4-methoxy-3-prop-2-ynoxyphenyl)but-3-enyl]benzoic acid (PubChem CID 75304278) has the molecular formula C21H18F2O4 and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-[2,2-difluoro-4-(4-methoxy-3-prop-2-ynoxyphenyl)but-3-enyl]benzoic acid.
| Compound Name | 2-[2,2-difluoro-4-(4-methoxy-3-prop-2-ynoxyphenyl)but-3-enyl]benzoic acid |
|---|---|
| PubChem CID | 75304278 |
| Molecular Formula | C21H18F2O4 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[2,2-difluoro-4-(4-methoxy-3-prop-2-ynoxyphenyl)but-3-enyl]benzoic acid |
| SMILES | C#CCOc1cc(C=CC(F)(F)Cc2ccccc2C(=O)O)ccc1OC |
| InChI | InChI=1S/C21H18F2O4/c1-3-12-27-19-13-15(8-9-18(19)26-2)10-11-21(22,23)14-16-6-4-5-7-17(16)20(24)25/h1,4-11,13H,12,14H2,2H3,(H,24,25) |
| InChIKey | HDCRVIUYBHNVSJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|