C20H17F2NO4 — CID 91454133
2-[[1,1-difluoro-3-(4-methoxy-3-prop-2-ynoxyphenyl)prop-2-enyl]amino]benzoic acid (PubChem CID 91454133) has the molecular formula C20H17F2NO4 and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-[[1,1-difluoro-3-(4-methoxy-3-prop-2-ynoxyphenyl)prop-2-enyl]amino]benzoic acid.
| Compound Name | 2-[[1,1-difluoro-3-(4-methoxy-3-prop-2-ynoxyphenyl)prop-2-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 91454133 |
| Molecular Formula | C20H17F2NO4 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[[1,1-difluoro-3-(4-methoxy-3-prop-2-ynoxyphenyl)prop-2-enyl]amino]benzoic acid |
| SMILES | C#CCOc1cc(C=CC(F)(F)Nc2ccccc2C(=O)O)ccc1OC |
| InChI | InChI=1S/C20H17F2NO4/c1-3-12-27-18-13-14(8-9-17(18)26-2)10-11-20(21,22)23-16-7-5-4-6-15(16)19(24)25/h1,4-11,13,23H,12H2,2H3,(H,24,25) |
| InChIKey | OGAHXHQYRPHUDY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|