About (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide
(2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide (PubChem CID 21191529) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide.
Molecular Properties
| Compound Name | (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide |
| PubChem CID | 21191529 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide |
| SMILES | CO/N=C(C(=O)N(C)C)/C(C)=N/OCc1ccc(C)cc1 |
| InChI | InChI=1S/C15H21N3O3/c1-11-6-8-13(9-7-11)10-21-16-12(2)14(17-20-5)15(19)18(3)4/h6-9H,10H2,1-5H3/b16-12+,17-14- |
| InChIKey | BFXSCKCBNRQYHH-KWOQVVRBSA-N |
| XLogP | 1.98 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide?
The IUPAC name of (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide (CID 21191529) is (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide.
What is the SMILES notation for (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide?
The canonical SMILES for (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide is CO/N=C(C(=O)N(C)C)/C(C)=N/OCc1ccc(C)cc1.
What is the InChIKey of (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide?
The InChIKey is BFXSCKCBNRQYHH-KWOQVVRBSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-11-6-8-13(9-7-11)10-21-16-12(2)14(17-20-5)15(19)18(3)4/h6-9H,10H2,1-5H3/b16-12+,17-14-.
What are the key properties of (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide?
(2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide has a molecular weight of 291.35 g/mol, XLogP of 1.98, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,3E)-2-methoxyimino-N,N-dimethyl-3-[(4-methylphenyl)methoxyimino]butanamide is sourced from PubChem (CID 21191529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).