C15H17N3O3S — CID 136870524
5-(1,3-benzodioxol-5-yl)-N-[[(2R)-oxolan-2-yl]methyl]-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 136870524) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-[[(2R)-oxolan-2-yl]methyl]-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-[[(2R)-oxolan-2-yl]methyl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 136870524 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-[[(2R)-oxolan-2-yl]methyl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | c1cc2c(cc1C1=NN/C(=N/C[C@H]3CCCO3)SC1)OCO2 |
| InChI | InChI=1S/C15H17N3O3S/c1-2-11(19-5-1)7-16-15-18-17-12(8-22-15)10-3-4-13-14(6-10)21-9-20-13/h3-4,6,11H,1-2,5,7-9H2,(H,16,18)/t11-/m1/s1 |
| InChIKey | LMSHVGCSGRVODS-LLVKDONJSA-N |
| XLogP | 1.99 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|