C8H12ClN3O3 — CID 136870611
5-chloro-4-[(1-hydroxy-3-methoxypropan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136870611) has the molecular formula C8H12ClN3O3 and a molecular weight of 233.65 g/mol. Its IUPAC name is 5-chloro-4-[(1-hydroxy-3-methoxypropan-2-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[(1-hydroxy-3-methoxypropan-2-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136870611 |
| Molecular Formula | C8H12ClN3O3 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-chloro-4-[(1-hydroxy-3-methoxypropan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | COCC(CO)Nc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H12ClN3O3/c1-15-3-5(2-13)12-7-6(9)8(14)11-4-10-7/h4-5,13H,2-3H2,1H3,(H2,10,11,12,14) |
| InChIKey | MQAIPJNTPALEAU-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |