C8H13ClN4O2 — CID 136870582
4-[(1-amino-3-methoxypropan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136870582) has the molecular formula C8H13ClN4O2 and a molecular weight of 232.67 g/mol. Its IUPAC name is 4-[(1-amino-3-methoxypropan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-amino-3-methoxypropan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136870582 |
| Molecular Formula | C8H13ClN4O2 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-[(1-amino-3-methoxypropan-2-yl)amino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | COCC(CN)Nc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H13ClN4O2/c1-15-3-5(2-10)13-7-6(9)8(14)12-4-11-7/h4-5H,2-3,10H2,1H3,(H2,11,12,13,14) |
| InChIKey | LFLIXUDIPKNOCX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |