C9H17N5O2 — CID 136901093
5-amino-4-[(4-amino-1-methoxybutan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136901093) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 5-amino-4-[(4-amino-1-methoxybutan-2-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[(4-amino-1-methoxybutan-2-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136901093 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-amino-4-[(4-amino-1-methoxybutan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | COCC(CCN)Nc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C9H17N5O2/c1-16-4-6(2-3-10)14-8-7(11)9(15)13-5-12-8/h5-6H,2-4,10-11H2,1H3,(H2,12,13,14,15) |
| InChIKey | LZHWOUPKYZNAKB-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |