C7H10N4O3 — CID 136958424
2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]propanoic acid (PubChem CID 136958424) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]propanoic acid.
| Compound Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 136958424 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]propanoic acid |
| SMILES | CC(Nc1nc[nH]c(=O)c1N)C(=O)O |
| InChI | InChI=1S/C7H10N4O3/c1-3(7(13)14)11-5-4(8)6(12)10-2-9-5/h2-3H,8H2,1H3,(H,13,14)(H2,9,10,11,12) |
| InChIKey | QYDIVDQLQGUPHY-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |