C9H10N4O3 — CID 136972283
2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]pent-4-ynoic acid (PubChem CID 136972283) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]pent-4-ynoic acid.
| Compound Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 136972283 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]pent-4-ynoic acid |
| SMILES | C#CCC(Nc1nc[nH]c(=O)c1N)C(=O)O |
| InChI | InChI=1S/C9H10N4O3/c1-2-3-5(9(15)16)13-7-6(10)8(14)12-4-11-7/h1,4-5H,3,10H2,(H,15,16)(H2,11,12,13,14) |
| InChIKey | CFSPZTPUAMFTRT-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|