C11H19N5O2 — CID 137016633
2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-N-tert-butylpropanamide (PubChem CID 137016633) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-N-tert-butylpropanamide.
| Compound Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 137016633 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-N-tert-butylpropanamide |
| SMILES | CC(Nc1nc[nH]c(=O)c1N)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H19N5O2/c1-6(9(17)16-11(2,3)4)15-8-7(12)10(18)14-5-13-8/h5-6H,12H2,1-4H3,(H,16,17)(H2,13,14,15,18) |
| InChIKey | CGKSGPUSLOAHNY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |