C10H14IN3O — CID 136870777
4-(2-cyclopropylpropan-2-ylamino)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136870777) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is 4-(2-cyclopropylpropan-2-ylamino)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(2-cyclopropylpropan-2-ylamino)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136870777 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-(2-cyclopropylpropan-2-ylamino)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(C)(Nc1nc[nH]c(=O)c1I)C1CC1 |
| InChI | InChI=1S/C10H14IN3O/c1-10(2,6-3-4-6)14-8-7(11)9(15)13-5-12-8/h5-6H,3-4H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | KSHZVPPBUYRMHK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|