C12H19N5O3S — CID 136872646
(6R)-6-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136872646) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is (6R)-6-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (6R)-6-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136872646 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (6R)-6-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC(=O)c1cnn2c1NC[C@@H](CN[C@H]1CCS(=O)(=O)C1)C2 |
| InChI | InChI=1S/C12H19N5O3S/c13-11(18)10-5-16-17-6-8(4-15-12(10)17)3-14-9-1-2-21(19,20)7-9/h5,8-9,14-15H,1-4,6-7H2,(H2,13,18)/t8-,9+/m1/s1 |
| InChIKey | AFUHCGCHSPMSPL-BDAKNGLRSA-N |
| XLogP | -1.20 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |