C8H12N4O3S — CID 83240990
5-amino-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxamide (PubChem CID 83240990) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 5-amino-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 83240990 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 5-amino-1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(C2CCS(=O)(=O)C2)c1N |
| InChI | InChI=1S/C8H12N4O3S/c9-7-6(8(10)13)3-11-12(7)5-1-2-16(14,15)4-5/h3,5H,1-2,4,9H2,(H2,10,13) |
| InChIKey | MHKAIDHBUVHQPS-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |