C8H12ClN3O2S — CID 63921845
4-chloro-1-(1,1-dioxothian-3-yl)pyrazol-5-amine (PubChem CID 63921845) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is 4-chloro-1-(1,1-dioxothian-3-yl)pyrazol-5-amine.
| Compound Name | 4-chloro-1-(1,1-dioxothian-3-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 63921845 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 4-chloro-1-(1,1-dioxothian-3-yl)pyrazol-5-amine |
| SMILES | Nc1c(Cl)cnn1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H12ClN3O2S/c9-7-4-11-12(8(7)10)6-2-1-3-15(13,14)5-6/h4,6H,1-3,5,10H2 |
| InChIKey | SSCLLXCUYYZRET-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |