C15H16N6O4 — CID 136875334
N-(2-methyl-5-nitrophenyl)-2-[(6R)-2-methyl-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetamide (PubChem CID 136875334) has the molecular formula C15H16N6O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-2-[(6R)-2-methyl-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-2-[(6R)-2-methyl-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetamide |
|---|---|
| PubChem CID | 136875334 |
| Molecular Formula | C15H16N6O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-2-[(6R)-2-methyl-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetamide |
| SMILES | Cc1nc2n(n1)C[C@@H](CC(=O)Nc1cc([N+](=O)[O-])ccc1C)C(=O)N2 |
| InChI | InChI=1S/C15H16N6O4/c1-8-3-4-11(21(24)25)6-12(8)17-13(22)5-10-7-20-15(18-14(10)23)16-9(2)19-20/h3-4,6,10H,5,7H2,1-2H3,(H,17,22)(H,16,18,19,23)/t10-/m1/s1 |
| InChIKey | ANSRLBXCPQCPCV-SNVBAGLBSA-N |
| XLogP | 1.40 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|