C21H12BrNO3 — CID 136880936
1-[(5-bromo-2-hydroxyphenyl)methylideneamino]anthracene-9,10-dione (PubChem CID 136880936) has the molecular formula C21H12BrNO3 and a molecular weight of 406.24 g/mol. Its IUPAC name is 1-[(5-bromo-2-hydroxyphenyl)methylideneamino]anthracene-9,10-dione.
| Compound Name | 1-[(5-bromo-2-hydroxyphenyl)methylideneamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 136880936 |
| Molecular Formula | C21H12BrNO3 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 1-[(5-bromo-2-hydroxyphenyl)methylideneamino]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(/N=C/c3cc(Br)ccc3O)cccc21 |
| InChI | InChI=1S/C21H12BrNO3/c22-13-8-9-18(24)12(10-13)11-23-17-7-3-6-16-19(17)21(26)15-5-2-1-4-14(15)20(16)25/h1-11,24H/b23-11+ |
| InChIKey | QBDQXRWLWIDSJY-FOKLQQMPSA-N |
| XLogP | 4.68 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|