C51H48N6 — CID 136883607
5-(1-methylimidazol-2-yl)-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin (PubChem CID 136883607) has the molecular formula C51H48N6 and a molecular weight of 744.99 g/mol. Its IUPAC name is 5-(1-methylimidazol-2-yl)-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-(1-methylimidazol-2-yl)-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136883607 |
| Molecular Formula | C51H48N6 |
| Molecular Weight | 744.99 g/mol |
| Exact Mass | 744.39 |
| IUPAC Name | 5-(1-methylimidazol-2-yl)-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4nccn4C)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C51H48N6/c1-27-21-30(4)44(31(5)22-27)47-36-11-13-38(53-36)48(45-32(6)23-28(2)24-33(45)7)40-15-17-42(55-40)50(51-52-19-20-57(51)10)43-18-16-41(56-43)49(39-14-12-37(47)54-39)46-34(8)25-29(3)26-35(46)9/h11-26,53,56H,1-10H3/b47-36+,47-37+,48-38+,48-40+,49-39+,49-41+,50-42+,50-43+ |
| InChIKey | XJNWADVHBIXMMF-WOFVLLFMSA-N |
| XLogP | 12.83 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.99 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |