C15H19N5O3 — CID 136886787
(4S)-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-5-oxo-1,4-dihydropyrazole-4-carboxamide (PubChem CID 136886787) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is (4S)-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-5-oxo-1,4-dihydropyrazole-4-carboxamide.
| Compound Name | (4S)-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-5-oxo-1,4-dihydropyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136886787 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (4S)-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-5-oxo-1,4-dihydropyrazole-4-carboxamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)[C@H]2C=NNC2=O)c(O)c1 |
| InChI | InChI=1S/C15H19N5O3/c1-3-20(4-2)11-6-5-10(13(21)7-11)8-16-18-14(22)12-9-17-19-15(12)23/h5-9,12,21H,3-4H2,1-2H3,(H,18,22)(H,19,23)/b16-8-/t12-/m1/s1 |
| InChIKey | INIBADBXVWMAKN-VJMCZWTHSA-N |
| XLogP | 0.42 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|