C21H25N3O2 — CID 1223205
trans-(1S,2S)-N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 1223205) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is trans-(1S,2S)-N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 1223205 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | trans-(1S,2S)-N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)[C@H]2C[C@@H]2c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-3-24(4-2)17-11-10-16(20(25)12-17)14-22-23-21(26)19-13-18(19)15-8-6-5-7-9-15/h5-12,14,18-19,25H,3-4,13H2,1-2H3,(H,23,26)/t18-,19+/m1/s1 |
| InChIKey | AIKMOTBHRVZUBI-MOPGFXCFSA-N |
| XLogP | 3.49 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|