C9H9F5N2O2 — CID 136890426
5-fluoro-4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890426) has the molecular formula C9H9F5N2O2 and a molecular weight of 272.17 g/mol. Its IUPAC name is 5-fluoro-4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890426 |
| Molecular Formula | C9H9F5N2O2 |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-fluoro-4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(COCC(F)(F)C(F)F)[nH]c(=O)c1F |
| InChI | InChI=1S/C9H9F5N2O2/c1-4-6(10)7(17)16-5(15-4)2-18-3-9(13,14)8(11)12/h8H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | NPDMQUQAPVNICZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|