C14H9FN2OS — CID 136893143
(4E)-2-(4-fluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one (PubChem CID 136893143) has the molecular formula C14H9FN2OS and a molecular weight of 272.30 g/mol. Its IUPAC name is (4E)-2-(4-fluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one.
| Compound Name | (4E)-2-(4-fluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893143 |
| Molecular Formula | C14H9FN2OS |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (4E)-2-(4-fluorophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(F)cc2)=N/C1=C/c1cccs1 |
| InChI | InChI=1S/C14H9FN2OS/c15-10-5-3-9(4-6-10)13-16-12(14(18)17-13)8-11-2-1-7-19-11/h1-8H,(H,16,17,18)/b12-8+ |
| InChIKey | TURBOJMSBNYEGP-XYOKQWHBSA-N |
| XLogP | 2.80 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|