C24H22FN5O3 — CID 136896676
(5R)-N-(2-fluoro-4-methylphenyl)-2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136896676) has the molecular formula C24H22FN5O3 and a molecular weight of 447.47 g/mol. Its IUPAC name is (5R)-N-(2-fluoro-4-methylphenyl)-2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-N-(2-fluoro-4-methylphenyl)-2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136896676 |
| Molecular Formula | C24H22FN5O3 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (5R)-N-(2-fluoro-4-methylphenyl)-2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CC(=O)Nc3nc(N4c5ccccc5C[C@H]4C)[nH]c(=O)c32)c(F)c1 |
| InChI | InChI=1S/C24H22FN5O3/c1-12-7-8-17(16(25)9-12)26-22(32)15-11-19(31)27-21-20(15)23(33)29-24(28-21)30-13(2)10-14-5-3-4-6-18(14)30/h3-9,13,15H,10-11H2,1-2H3,(H,26,32)(H2,27,28,29,31,33)/t13-,15-/m1/s1 |
| InChIKey | WNVNKWIQJOWGFZ-UKRRQHHQSA-N |
| XLogP | 3.36 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |