C8H10BrF2N3O2 — CID 136896835
5-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrimidin-6-one (PubChem CID 136896835) has the molecular formula C8H10BrF2N3O2 and a molecular weight of 298.09 g/mol. Its IUPAC name is 5-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136896835 |
| Molecular Formula | C8H10BrF2N3O2 |
| Molecular Weight | 298.09 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 5-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCOCC(F)F)c1Br |
| InChI | InChI=1S/C8H10BrF2N3O2/c9-6-7(13-4-14-8(6)15)12-1-2-16-3-5(10)11/h4-5H,1-3H2,(H2,12,13,14,15) |
| InChIKey | PHJGIGRAYDHAOQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.09 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|