C8H9BrF3N3O2 — CID 136956680
5-bromo-4-[2-(2,2,2-trifluoroethoxy)ethylamino]-1H-pyrimidin-6-one (PubChem CID 136956680) has the molecular formula C8H9BrF3N3O2 and a molecular weight of 316.08 g/mol. Its IUPAC name is 5-bromo-4-[2-(2,2,2-trifluoroethoxy)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[2-(2,2,2-trifluoroethoxy)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956680 |
| Molecular Formula | C8H9BrF3N3O2 |
| Molecular Weight | 316.08 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 5-bromo-4-[2-(2,2,2-trifluoroethoxy)ethylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCOCC(F)(F)F)c1Br |
| InChI | InChI=1S/C8H9BrF3N3O2/c9-5-6(14-4-15-7(5)16)13-1-2-17-3-8(10,11)12/h4H,1-3H2,(H2,13,14,15,16) |
| InChIKey | ATLOIEJRTXUCCZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.08 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|