C7H6ClN3O — CID 136898084
6-chloro-3-methyl-2,7-dihydropyrazolo[3,4-b]pyridin-4-one (PubChem CID 136898084) has the molecular formula C7H6ClN3O and a molecular weight of 183.60 g/mol. Its IUPAC name is 6-chloro-3-methyl-2,7-dihydropyrazolo[3,4-b]pyridin-4-one.
| Compound Name | 6-chloro-3-methyl-2,7-dihydropyrazolo[3,4-b]pyridin-4-one |
|---|---|
| PubChem CID | 136898084 |
| Molecular Formula | C7H6ClN3O |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 6-chloro-3-methyl-2,7-dihydropyrazolo[3,4-b]pyridin-4-one |
| SMILES | Cc1[nH]nc2[nH]c(Cl)cc(=O)c12 |
| InChI | InChI=1S/C7H6ClN3O/c1-3-6-4(12)2-5(8)9-7(6)11-10-3/h2H,1H3,(H2,9,10,11,12) |
| InChIKey | TZUREDZDXSWNSX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|